PRODUCTS
Lomustine |
| Product name: | Lomustine |
| CAS No.: | 13010-47-4 |
| EINECS No.: | 235-859-2 |
| Molecular weight: | 233.6952 |
| Molecular formula: | C9H16ClN3O2 |
| InChI: | InChI=1/C9H16ClN3O2/c1-2-12(10)9(14)13(11-15)8-6-4-3-5-7-8/h8H,2-7H2,1H3 |
| Structural formula: |  |
| Density: | 1.31g/cm3 |
| Melting point: | 88-90℃ |
| Boiling point: | 296.6°C at 760 mmHg |
| Flash point: | 133.2°C |
| Vapor pressure: | 0.00142mmHg at 25°C |
| Uses: | Alkylating agent class cancer drug, can alkylation reaction with cell component, nucleophilic group and the main blows to nucleic acid alkylation object, the structure and function of DNA damage, cell division to stop or die.It has good curative effect on glioma, lung cancer and lymphoma, and it also has some effect on the central nervous system leukemia. |
